C22H28O4 — CID 71741069
[(1R,3R,6Z,8R,9E)-3,7,11,11,14-pentamethyl-15-oxo-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate (PubChem CID 71741069) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(1R,3R,6Z,8R,9E)-3,7,11,11,14-pentamethyl-15-oxo-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate.
| Compound Name | [(1R,3R,6Z,8R,9E)-3,7,11,11,14-pentamethyl-15-oxo-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 71741069 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1R,3R,6Z,8R,9E)-3,7,11,11,14-pentamethyl-15-oxo-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C\C(C)(C)CC2=C(C)C(=O)[C@]3(C[C@@H](C)C=C3/C=C\1C)O2 |
| InChI | InChI=1S/C22H28O4/c1-13-9-17-10-14(2)18(25-16(4)23)7-8-21(5,6)12-19-15(3)20(24)22(17,11-13)26-19/h7-10,13,18H,11-12H2,1-6H3/b8-7-,14-10-/t13-,18+,22+/m0/s1 |
| InChIKey | PIXKZMCQNFTURC-YYISUWTRSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|