C24H32O5 — CID 71741070
[(1R,3R,6Z,8S,9E,15R)-15-acetyloxy-3,7,11,11,14-pentamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate (PubChem CID 71741070) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(1R,3R,6Z,8S,9E,15R)-15-acetyloxy-3,7,11,11,14-pentamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate.
| Compound Name | [(1R,3R,6Z,8S,9E,15R)-15-acetyloxy-3,7,11,11,14-pentamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 71741070 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R,3R,6Z,8S,9E,15R)-15-acetyloxy-3,7,11,11,14-pentamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraen-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C\C(C)(C)CC2=C(C)[C@@H](OC(C)=O)[C@]3(C[C@@H](C)C=C3/C=C\1C)O2 |
| InChI | InChI=1S/C24H32O5/c1-14-10-19-11-15(2)20(27-17(4)25)8-9-23(6,7)13-21-16(3)22(28-18(5)26)24(19,12-14)29-21/h8-11,14,20,22H,12-13H2,1-7H3/b9-8-,15-11-/t14-,20-,22+,24+/m0/s1 |
| InChIKey | BMGXMFMQTBCDGL-GDCKBDKBSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|