About 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride
2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride (PubChem CID 71741576) has the molecular formula C7H13Cl2N3O
and a molecular weight of 226.11 g/mol. Its IUPAC name is 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride |
| PubChem CID | 71741576 |
| Molecular Formula | C7H13Cl2N3O |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride |
| SMILES | Cc1nnc(C2CCNC2)o1.Cl.Cl |
| InChI | InChI=1S/C7H11N3O.2ClH/c1-5-9-10-7(11-5)6-2-3-8-4-6;;/h6,8H,2-4H2,1H3;2*1H |
| InChIKey | QCEBYINEXLGLAM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride?
The IUPAC name of 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride (CID 71741576) is 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride.
What is the SMILES notation for 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride?
The canonical SMILES for 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride is Cc1nnc(C2CCNC2)o1.Cl.Cl.
What is the InChIKey of 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride?
The InChIKey is QCEBYINEXLGLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.2ClH/c1-5-9-10-7(11-5)6-2-3-8-4-6;;/h6,8H,2-4H2,1H3;2*1H.
What are the key properties of 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride?
2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride has a molecular weight of 226.11 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;dihydrochloride is sourced from PubChem (CID 71741576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).