C12H12N2S — CID 71741580
4-pyridin-3-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 71741580) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-pyridin-3-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 4-pyridin-3-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 71741580 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-pyridin-3-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | c1cncc(C2NCCc3sccc32)c1 |
| InChI | InChI=1S/C12H12N2S/c1-2-9(8-13-5-1)12-10-4-7-15-11(10)3-6-14-12/h1-2,4-5,7-8,12,14H,3,6H2 |
| InChIKey | VFMHJJPZRDRFGU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |