About 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride
6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride (PubChem CID 71741588) has the molecular formula C6H8ClN3
and a molecular weight of 157.60 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride |
| PubChem CID | 71741588 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride |
| SMILES | Cl.c1cnc2c(n1)CNC2 |
| InChI | InChI=1S/C6H7N3.ClH/c1-2-9-6-4-7-3-5(6)8-1;/h1-2,7H,3-4H2;1H |
| InChIKey | OBNGJWDRGTWXLN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride (CID 71741588) is 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride is Cl.c1cnc2c(n1)CNC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride?
The InChIKey is OBNGJWDRGTWXLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3.ClH/c1-2-9-6-4-7-3-5(6)8-1;/h1-2,7H,3-4H2;1H.
What are the key properties of 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride?
6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride has a molecular weight of 157.60 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[3,4-b]pyrazine;hydrochloride is sourced from PubChem (CID 71741588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).