About 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline
1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline (PubChem CID 71741638) has the molecular formula C12H9BrClN3
and a molecular weight of 310.58 g/mol. Its IUPAC name is 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline |
| PubChem CID | 71741638 |
| Molecular Formula | C12H9BrClN3 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline |
| SMILES | Cc1cc2nc(Cl)c3ncc(Br)n3c2cc1C |
| InChI | InChI=1S/C12H9BrClN3/c1-6-3-8-9(4-7(6)2)17-10(13)5-15-12(17)11(14)16-8/h3-5H,1-2H3 |
| InChIKey | UKVJZVSOGZEXJU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline?
The IUPAC name of 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline (CID 71741638) is 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline.
What is the SMILES notation for 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline?
The canonical SMILES for 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline is Cc1cc2nc(Cl)c3ncc(Br)n3c2cc1C.
What is the InChIKey of 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline?
The InChIKey is UKVJZVSOGZEXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrClN3/c1-6-3-8-9(4-7(6)2)17-10(13)5-15-12(17)11(14)16-8/h3-5H,1-2H3.
What are the key properties of 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline?
1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline has a molecular weight of 310.58 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-chloro-7,8-dimethylimidazo[1,2-a]quinoxaline is sourced from PubChem (CID 71741638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).