About 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine
8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 71742729) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 71742729 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC1CNc2cccc(Br)c2O1 |
| InChI | InChI=1S/C9H10BrNO/c1-6-5-11-8-4-2-3-7(10)9(8)12-6/h2-4,6,11H,5H2,1H3 |
| InChIKey | YGRVNMAXPWMNPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 71742729) is 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is CC1CNc2cccc(Br)c2O1.
What is the InChIKey of 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is YGRVNMAXPWMNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c1-6-5-11-8-4-2-3-7(10)9(8)12-6/h2-4,6,11H,5H2,1H3.
What are the key properties of 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 228.09 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 71742729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).