C9H10BrNS — CID 71742733
8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 71742733) has the molecular formula C9H10BrNS and a molecular weight of 244.16 g/mol. Its IUPAC name is 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 71742733 |
| Molecular Formula | C9H10BrNS |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 8-bromo-2-methyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CC1CNc2cccc(Br)c2S1 |
| InChI | InChI=1S/C9H10BrNS/c1-6-5-11-8-4-2-3-7(10)9(8)12-6/h2-4,6,11H,5H2,1H3 |
| InChIKey | TUHHWWCOLKIZRF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |