About [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride
[(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride (PubChem CID 71742811) has the molecular formula C7H16ClNO2
and a molecular weight of 181.66 g/mol. Its IUPAC name is [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride |
| PubChem CID | 71742811 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride |
| SMILES | CC1(C)CNC[C@@H](CO)O1.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-7(2)5-8-3-6(4-9)10-7;/h6,8-9H,3-5H2,1-2H3;1H/t6-;/m0./s1 |
| InChIKey | JIPQEJGQWAORNN-RGMNGODLSA-N |
| XLogP | 0.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride?
The IUPAC name of [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride (CID 71742811) is [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride is CC1(C)CNC[C@@H](CO)O1.Cl.
What is the InChIKey of [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride?
The InChIKey is JIPQEJGQWAORNN-RGMNGODLSA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c1-7(2)5-8-3-6(4-9)10-7;/h6,8-9H,3-5H2,1-2H3;1H/t6-;/m0./s1.
What are the key properties of [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride?
[(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride has a molecular weight of 181.66 g/mol, XLogP of 0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-6,6-dimethylmorpholin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 71742811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).