About (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol
(4-benzyl-6,6-dimethylmorpholin-2-yl)methanol (PubChem CID 71742813) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol.
Molecular Properties
| Compound Name | (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol |
| PubChem CID | 71742813 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol |
| SMILES | CC1(C)CN(Cc2ccccc2)CC(CO)O1 |
| InChI | InChI=1S/C14H21NO2/c1-14(2)11-15(9-13(10-16)17-14)8-12-6-4-3-5-7-12/h3-7,13,16H,8-11H2,1-2H3 |
| InChIKey | RKNCXMQRTZZKDM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol?
The IUPAC name of (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol (CID 71742813) is (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol.
What is the SMILES notation for (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol?
The canonical SMILES for (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol is CC1(C)CN(Cc2ccccc2)CC(CO)O1.
What is the InChIKey of (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol?
The InChIKey is RKNCXMQRTZZKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-14(2)11-15(9-13(10-16)17-14)8-12-6-4-3-5-7-12/h3-7,13,16H,8-11H2,1-2H3.
What are the key properties of (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol?
(4-benzyl-6,6-dimethylmorpholin-2-yl)methanol has a molecular weight of 235.33 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzyl-6,6-dimethylmorpholin-2-yl)methanol is sourced from PubChem (CID 71742813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).