About 5-bromoquinolin-4-amine
5-bromoquinolin-4-amine (PubChem CID 71742979) has the molecular formula C9H7BrN2
and a molecular weight of 223.07 g/mol. Its IUPAC name is 5-bromoquinolin-4-amine.
Molecular Properties
| Compound Name | 5-bromoquinolin-4-amine |
| PubChem CID | 71742979 |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 5-bromoquinolin-4-amine |
| SMILES | Nc1ccnc2cccc(Br)c12 |
| InChI | InChI=1S/C9H7BrN2/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-5H,(H2,11,12) |
| InChIKey | HXWGAKFTZZFIJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromoquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoquinolin-4-amine?
The IUPAC name of 5-bromoquinolin-4-amine (CID 71742979) is 5-bromoquinolin-4-amine.
What is the SMILES notation for 5-bromoquinolin-4-amine?
The canonical SMILES for 5-bromoquinolin-4-amine is Nc1ccnc2cccc(Br)c12.
What is the InChIKey of 5-bromoquinolin-4-amine?
The InChIKey is HXWGAKFTZZFIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-5H,(H2,11,12).
What are the key properties of 5-bromoquinolin-4-amine?
5-bromoquinolin-4-amine has a molecular weight of 223.07 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoquinolin-4-amine is sourced from PubChem (CID 71742979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).