About 3-fluoroquinolin-8-ol
3-fluoroquinolin-8-ol (PubChem CID 71743010) has the molecular formula C9H6FNO
and a molecular weight of 163.15 g/mol. Its IUPAC name is 3-fluoroquinolin-8-ol.
Molecular Properties
| Compound Name | 3-fluoroquinolin-8-ol |
| PubChem CID | 71743010 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 3-fluoroquinolin-8-ol |
| SMILES | Oc1cccc2cc(F)cnc12 |
| InChI | InChI=1S/C9H6FNO/c10-7-4-6-2-1-3-8(12)9(6)11-5-7/h1-5,12H |
| InChIKey | YPZUUMHSIYTYEF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroquinolin-8-ol?
The IUPAC name of 3-fluoroquinolin-8-ol (CID 71743010) is 3-fluoroquinolin-8-ol.
What is the SMILES notation for 3-fluoroquinolin-8-ol?
The canonical SMILES for 3-fluoroquinolin-8-ol is Oc1cccc2cc(F)cnc12.
What is the InChIKey of 3-fluoroquinolin-8-ol?
The InChIKey is YPZUUMHSIYTYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO/c10-7-4-6-2-1-3-8(12)9(6)11-5-7/h1-5,12H.
What are the key properties of 3-fluoroquinolin-8-ol?
3-fluoroquinolin-8-ol has a molecular weight of 163.15 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroquinolin-8-ol is sourced from PubChem (CID 71743010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).