C13H13N3O2 — CID 71743190
tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 71743190) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 71743190 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2ccc(C#N)nc21 |
| InChI | InChI=1S/C13H13N3O2/c1-13(2,3)18-12(17)16-7-6-9-4-5-10(8-14)15-11(9)16/h4-7H,1-3H3 |
| InChIKey | MCQXNMBDBCEVIP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |