About 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile
2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile (PubChem CID 71743317) has the molecular formula C8H4N4O
and a molecular weight of 172.15 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile |
| PubChem CID | 71743317 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(-c2ncco2)nc1 |
| InChI | InChI=1S/C8H4N4O/c9-3-6-4-11-7(12-5-6)8-10-1-2-13-8/h1-2,4-5H |
| InChIKey | ZUPIVXYGHOXPTM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile?
The IUPAC name of 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile (CID 71743317) is 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile?
The canonical SMILES for 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile is N#Cc1cnc(-c2ncco2)nc1.
What is the InChIKey of 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile?
The InChIKey is ZUPIVXYGHOXPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4O/c9-3-6-4-11-7(12-5-6)8-10-1-2-13-8/h1-2,4-5H.
What are the key properties of 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile?
2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile has a molecular weight of 172.15 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazol-2-yl)pyrimidine-5-carbonitrile is sourced from PubChem (CID 71743317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).