About 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline
4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline (PubChem CID 71743370) has the molecular formula C12H9BrN4
and a molecular weight of 289.14 g/mol. Its IUPAC name is 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline.
Molecular Properties
| Compound Name | 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline |
| PubChem CID | 71743370 |
| Molecular Formula | C12H9BrN4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline |
| SMILES | Nc1ccc(-c2cnc3c(Br)cnn3c2)cc1 |
| InChI | InChI=1S/C12H9BrN4/c13-11-6-16-17-7-9(5-15-12(11)17)8-1-3-10(14)4-2-8/h1-7H,14H2 |
| InChIKey | DKMJFGNFBFLNGW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline?
The IUPAC name of 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline (CID 71743370) is 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline.
What is the SMILES notation for 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline?
The canonical SMILES for 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline is Nc1ccc(-c2cnc3c(Br)cnn3c2)cc1.
What is the InChIKey of 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline?
The InChIKey is DKMJFGNFBFLNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN4/c13-11-6-16-17-7-9(5-15-12(11)17)8-1-3-10(14)4-2-8/h1-7H,14H2.
What are the key properties of 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline?
4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline has a molecular weight of 289.14 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)aniline is sourced from PubChem (CID 71743370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).