About 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride
5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride (PubChem CID 71743419) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride |
| PubChem CID | 71743419 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride |
| SMILES | COc1ccc2c(c1)CC1(CCNCC1)C2=O.Cl |
| InChI | InChI=1S/C14H17NO2.ClH/c1-17-11-2-3-12-10(8-11)9-14(13(12)16)4-6-15-7-5-14;/h2-3,8,15H,4-7,9H2,1H3;1H |
| InChIKey | NFHFTNNABREQER-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride?
The IUPAC name of 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride (CID 71743419) is 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride.
What is the SMILES notation for 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride?
The canonical SMILES for 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride is COc1ccc2c(c1)CC1(CCNCC1)C2=O.Cl.
What is the InChIKey of 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride?
The InChIKey is NFHFTNNABREQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2.ClH/c1-17-11-2-3-12-10(8-11)9-14(13(12)16)4-6-15-7-5-14;/h2-3,8,15H,4-7,9H2,1H3;1H.
What are the key properties of 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride?
5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride has a molecular weight of 267.76 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyspiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride is sourced from PubChem (CID 71743419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).