About [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine
[1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine (PubChem CID 71743599) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine |
| PubChem CID | 71743599 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine |
| SMILES | NCc1nc2ccccn2n1 |
| InChI | InChI=1S/C7H8N4/c8-5-6-9-7-3-1-2-4-11(7)10-6/h1-4H,5,8H2 |
| InChIKey | WDZWUBFUAJAJSK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine?
The IUPAC name of [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine (CID 71743599) is [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine.
What is the SMILES notation for [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine?
The canonical SMILES for [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine is NCc1nc2ccccn2n1.
What is the InChIKey of [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine?
The InChIKey is WDZWUBFUAJAJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c8-5-6-9-7-3-1-2-4-11(7)10-6/h1-4H,5,8H2.
What are the key properties of [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine?
[1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine has a molecular weight of 148.17 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[1,5-a]pyridin-2-ylmethanamine is sourced from PubChem (CID 71743599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).