About 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine
2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine (PubChem CID 71743618) has the molecular formula C8H8ClNO
and a molecular weight of 169.61 g/mol. Its IUPAC name is 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine.
Molecular Properties
| Compound Name | 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine |
| PubChem CID | 71743618 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine |
| SMILES | Clc1ccc2c(n1)CCOC2 |
| InChI | InChI=1S/C8H8ClNO/c9-8-2-1-6-5-11-4-3-7(6)10-8/h1-2H,3-5H2 |
| InChIKey | VMIZASNDJVIUFE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine?
The IUPAC name of 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine (CID 71743618) is 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine.
What is the SMILES notation for 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine?
The canonical SMILES for 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine is Clc1ccc2c(n1)CCOC2.
What is the InChIKey of 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine?
The InChIKey is VMIZASNDJVIUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO/c9-8-2-1-6-5-11-4-3-7(6)10-8/h1-2H,3-5H2.
What are the key properties of 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine?
2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine has a molecular weight of 169.61 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridine is sourced from PubChem (CID 71743618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).