About 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one
2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 71743833) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 71743833 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc2c(n1)C(C)(C)NC2=O |
| InChI | InChI=1S/C10H12N2O2/c1-10(2)8-6(9(13)12-10)4-5-7(11-8)14-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | PZWRYLXDGPTZTO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one (CID 71743833) is 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one is COc1ccc2c(n1)C(C)(C)NC2=O.
What is the InChIKey of 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one?
The InChIKey is PZWRYLXDGPTZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-10(2)8-6(9(13)12-10)4-5-7(11-8)14-3/h4-5H,1-3H3,(H,12,13).
What are the key properties of 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one?
2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one has a molecular weight of 192.22 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 71743833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).