C9H10ClNO2 — CID 71743943
5-chloro-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 71743943) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 5-chloro-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 71743943 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(c(Cl)c1O)CCNC2 |
| InChI | InChI=1S/C9H10ClNO2/c10-8-6-1-2-11-4-5(6)3-7(12)9(8)13/h3,11-13H,1-2,4H2 |
| InChIKey | NKEQVZVUWFUCDA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|