About 2-amino-4-phenyl-1,3-thiazine-6-thione
2-amino-4-phenyl-1,3-thiazine-6-thione (PubChem CID 717441) has the molecular formula C10H8N2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-amino-4-phenyl-1,3-thiazine-6-thione.
Molecular Properties
| Compound Name | 2-amino-4-phenyl-1,3-thiazine-6-thione |
| PubChem CID | 717441 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 2-amino-4-phenyl-1,3-thiazine-6-thione |
| SMILES | Nc1nc(-c2ccccc2)cc(=S)s1 |
| InChI | InChI=1S/C10H8N2S2/c11-10-12-8(6-9(13)14-10)7-4-2-1-3-5-7/h1-6H,(H2,11,12) |
| InChIKey | PMCYYVHDPYDPOO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-phenyl-1,3-thiazine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-phenyl-1,3-thiazine-6-thione?
The IUPAC name of 2-amino-4-phenyl-1,3-thiazine-6-thione (CID 717441) is 2-amino-4-phenyl-1,3-thiazine-6-thione.
What is the SMILES notation for 2-amino-4-phenyl-1,3-thiazine-6-thione?
The canonical SMILES for 2-amino-4-phenyl-1,3-thiazine-6-thione is Nc1nc(-c2ccccc2)cc(=S)s1.
What is the InChIKey of 2-amino-4-phenyl-1,3-thiazine-6-thione?
The InChIKey is PMCYYVHDPYDPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2/c11-10-12-8(6-9(13)14-10)7-4-2-1-3-5-7/h1-6H,(H2,11,12).
What are the key properties of 2-amino-4-phenyl-1,3-thiazine-6-thione?
2-amino-4-phenyl-1,3-thiazine-6-thione has a molecular weight of 220.32 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-phenyl-1,3-thiazine-6-thione is sourced from PubChem (CID 717441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).