About spiro[3.5]nonan-3-amine;hydrochloride
spiro[3.5]nonan-3-amine;hydrochloride (PubChem CID 71744113) has the molecular formula C9H18ClN
and a molecular weight of 175.70 g/mol. Its IUPAC name is spiro[3.5]nonan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | spiro[3.5]nonan-3-amine;hydrochloride |
| PubChem CID | 71744113 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | spiro[3.5]nonan-3-amine;hydrochloride |
| SMILES | Cl.NC1CCC12CCCCC2 |
| InChI | InChI=1S/C9H17N.ClH/c10-8-4-7-9(8)5-2-1-3-6-9;/h8H,1-7,10H2;1H |
| InChIKey | QDPYUUBEDNAASQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[3.5]nonan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3.5]nonan-3-amine;hydrochloride?
The IUPAC name of spiro[3.5]nonan-3-amine;hydrochloride (CID 71744113) is spiro[3.5]nonan-3-amine;hydrochloride.
What is the SMILES notation for spiro[3.5]nonan-3-amine;hydrochloride?
The canonical SMILES for spiro[3.5]nonan-3-amine;hydrochloride is Cl.NC1CCC12CCCCC2.
What is the InChIKey of spiro[3.5]nonan-3-amine;hydrochloride?
The InChIKey is QDPYUUBEDNAASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.ClH/c10-8-4-7-9(8)5-2-1-3-6-9;/h8H,1-7,10H2;1H.
What are the key properties of spiro[3.5]nonan-3-amine;hydrochloride?
spiro[3.5]nonan-3-amine;hydrochloride has a molecular weight of 175.70 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3.5]nonan-3-amine;hydrochloride is sourced from PubChem (CID 71744113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).