C24H27N3O6 — CID 71744487
2-[[(9S,14S)-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carbonyl]amino]acetic acid (PubChem CID 71744487) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[[(9S,14S)-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(9S,14S)-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 71744487 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[[(9S,14S)-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carbonyl]amino]acetic acid |
| SMILES | C[C@H]1COc2cccc(c2)-c2cccc(c2)C(=O)N(C)[C@H](C(=O)NCC(=O)O)CCC(=O)N1 |
| InChI | InChI=1S/C24H27N3O6/c1-15-14-33-19-8-4-6-17(12-19)16-5-3-7-18(11-16)24(32)27(2)20(9-10-21(28)26-15)23(31)25-13-22(29)30/h3-8,11-12,15,20H,9-10,13-14H2,1-2H3,(H,25,31)(H,26,28)(H,29,30)/t15-,20-/m0/s1 |
| InChIKey | NGJQGYKZTAPNGI-YWZLYKJASA-N |
| XLogP | 1.67 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |