C24H30N4O3 — CID 71744520
(E)-4-methoxy-N-[3-[(8E)-8-methoxyimino-6,7-dihydro-5H-quinolin-2-yl]propoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 71744520) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (E)-4-methoxy-N-[3-[(8E)-8-methoxyimino-6,7-dihydro-5H-quinolin-2-yl]propoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-4-methoxy-N-[3-[(8E)-8-methoxyimino-6,7-dihydro-5H-quinolin-2-yl]propoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 71744520 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (E)-4-methoxy-N-[3-[(8E)-8-methoxyimino-6,7-dihydro-5H-quinolin-2-yl]propoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CO/N=C1\CCCc2ccc(CCCO/N=C3\CCCc4c(OC)cc(C)nc43)nc21 |
| InChI | InChI=1S/C24H30N4O3/c1-16-15-22(29-2)19-9-5-11-21(24(19)25-16)28-31-14-6-8-18-13-12-17-7-4-10-20(27-30-3)23(17)26-18/h12-13,15H,4-11,14H2,1-3H3/b27-20+,28-21+ |
| InChIKey | KRAHJLJAJSDTMS-KUKFKUQFSA-N |
| XLogP | 4.17 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|