C20H20ClNO3 — CID 71745117
4-[(4aR,5S,10bR)-9-chloro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-3-methylbenzoic acid (PubChem CID 71745117) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-[(4aR,5S,10bR)-9-chloro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-3-methylbenzoic acid.
| Compound Name | 4-[(4aR,5S,10bR)-9-chloro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 71745117 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[(4aR,5S,10bR)-9-chloro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1[C@H]1Nc2ccc(Cl)cc2[C@@H]2OCCC[C@H]12 |
| InChI | InChI=1S/C20H20ClNO3/c1-11-9-12(20(23)24)4-6-14(11)18-15-3-2-8-25-19(15)16-10-13(21)5-7-17(16)22-18/h4-7,9-10,15,18-19,22H,2-3,8H2,1H3,(H,23,24)/t15-,18-,19-/m1/s1 |
| InChIKey | NNUPTELPCSDVKM-ATZDWAIDSA-N |
| XLogP | 4.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |