C10H13FN6O3 — CID 71745353
(2R,3R,4R,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 71745353) has the molecular formula C10H13FN6O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 71745353 |
| Molecular Formula | C10H13FN6O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R,3R,4R,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(N)c2ncc([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3F)n2n1 |
| InChI | InChI=1S/C10H13FN6O3/c11-5-6(19)4(2-18)20-7(5)3-1-14-9-8(12)15-10(13)16-17(3)9/h1,4-7,18-19H,2H2,(H4,12,13,15,16)/t4-,5-,6-,7+/m1/s1 |
| InChIKey | JZNRZGVVHASRGM-GBNDHIKLSA-N |
| XLogP | -1.58 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|