About (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol
(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol (PubChem CID 71745416) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol |
| PubChem CID | 71745416 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol |
| SMILES | C#C[C@@H](C)C[C@H]1O[C@@H]1[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C12H20O2/c1-5-8(3)7-11-12(14-11)9(4)10(13)6-2/h1,8-13H,6-7H2,2-4H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | MSBXRBIYQBXGRD-RMPHRYRLSA-N |
| XLogP | 1.82 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol?
The IUPAC name of (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol (CID 71745416) is (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol.
What is the SMILES notation for (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol?
The canonical SMILES for (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol is C#C[C@@H](C)C[C@H]1O[C@@H]1[C@H](C)[C@@H](O)CC.
What is the InChIKey of (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol?
The InChIKey is MSBXRBIYQBXGRD-RMPHRYRLSA-N. The full InChI is InChI=1S/C12H20O2/c1-5-8(3)7-11-12(14-11)9(4)10(13)6-2/h1,8-13H,6-7H2,2-4H3/t8-,9-,10+,11-,12-/m1/s1.
What are the key properties of (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol?
(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol has a molecular weight of 196.29 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol is sourced from PubChem (CID 71745416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).