About (E)-undec-4-en-1-yn-3-ol
(E)-undec-4-en-1-yn-3-ol (PubChem CID 71745536) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (E)-undec-4-en-1-yn-3-ol.
Molecular Properties
| Compound Name | (E)-undec-4-en-1-yn-3-ol |
| PubChem CID | 71745536 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (E)-undec-4-en-1-yn-3-ol |
| SMILES | C#CC(O)/C=C/CCCCCC |
| InChI | InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h2,9-12H,3,5-8H2,1H3/b10-9+ |
| InChIKey | XSEMXLZWKDTMJS-MDZDMXLPSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-undec-4-en-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-undec-4-en-1-yn-3-ol?
The IUPAC name of (E)-undec-4-en-1-yn-3-ol (CID 71745536) is (E)-undec-4-en-1-yn-3-ol.
What is the SMILES notation for (E)-undec-4-en-1-yn-3-ol?
The canonical SMILES for (E)-undec-4-en-1-yn-3-ol is C#CC(O)/C=C/CCCCCC.
What is the InChIKey of (E)-undec-4-en-1-yn-3-ol?
The InChIKey is XSEMXLZWKDTMJS-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h2,9-12H,3,5-8H2,1H3/b10-9+.
What are the key properties of (E)-undec-4-en-1-yn-3-ol?
(E)-undec-4-en-1-yn-3-ol has a molecular weight of 166.26 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-undec-4-en-1-yn-3-ol is sourced from PubChem (CID 71745536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).