C19H24N2O10S — CID 71745680
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[(5-acetyl-1,3-thiazol-2-yl)amino]oxan-2-yl]methyl acetate (PubChem CID 71745680) has the molecular formula C19H24N2O10S and a molecular weight of 472.47 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[(5-acetyl-1,3-thiazol-2-yl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[(5-acetyl-1,3-thiazol-2-yl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71745680 |
| Molecular Formula | C19H24N2O10S |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[(5-acetyl-1,3-thiazol-2-yl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Nc2ncc(C(C)=O)s2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24N2O10S/c1-8(22)14-6-20-19(32-14)21-18-17(30-12(5)26)16(29-11(4)25)15(28-10(3)24)13(31-18)7-27-9(2)23/h6,13,15-18H,7H2,1-5H3,(H,20,21)/t13-,15-,16+,17+,18+/m1/s1 |
| InChIKey | XKDWFGYROPKPIG-MWIANEHASA-N |
| XLogP | 0.84 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|