C19H21F3N2O10S — CID 71745864
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate (PubChem CID 71745864) has the molecular formula C19H21F3N2O10S and a molecular weight of 526.44 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71745864 |
| Molecular Formula | C19H21F3N2O10S |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[5-(2,2,2-trifluoroacetyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Nc2ncc(C(=O)C(F)(F)F)s2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H21F3N2O10S/c1-7(25)30-6-11-13(31-8(2)26)14(32-9(3)27)15(33-10(4)28)17(34-11)24-18-23-5-12(35-18)16(29)19(20,21)22/h5,11,13-15,17H,6H2,1-4H3,(H,23,24)/t11-,13-,14+,15+,17+/m1/s1 |
| InChIKey | RCZZEGLVOUAMLD-ZJBDGZLFSA-N |
| XLogP | 1.38 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|