C16H18N2O6S — CID 71745866
phenyl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone (PubChem CID 71745866) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is phenyl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | phenyl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 71745866 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | phenyl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccccc1)c1cnc(N[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)s1 |
| InChI | InChI=1S/C16H18N2O6S/c19-7-9-12(21)13(22)14(23)15(24-9)18-16-17-6-10(25-16)11(20)8-4-2-1-3-5-8/h1-6,9,12-15,19,21-23H,7H2,(H,17,18)/t9-,12-,13+,14+,15+/m1/s1 |
| InChIKey | RPZYJKFUHREXIP-FCHWROMDSA-N |
| XLogP | -0.41 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |