C17H20N2O6S — CID 71745868
(4-methylphenyl)-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone (PubChem CID 71745868) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is (4-methylphenyl)-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | (4-methylphenyl)-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 71745868 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (4-methylphenyl)-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
| SMILES | Cc1ccc(C(=O)c2cnc(N[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)s2)cc1 |
| InChI | InChI=1S/C17H20N2O6S/c1-8-2-4-9(5-3-8)12(21)11-6-18-17(26-11)19-16-15(24)14(23)13(22)10(7-20)25-16/h2-6,10,13-16,20,22-24H,7H2,1H3,(H,18,19)/t10-,13-,14+,15+,16+/m1/s1 |
| InChIKey | QPLOFCQLVNSJOB-DMHMKPBJSA-N |
| XLogP | -0.11 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |