C15H22N2O6S2 — CID 71746064
N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[2-(2-sulfanylethoxy)ethylsulfanyl]acetamide (PubChem CID 71746064) has the molecular formula C15H22N2O6S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[2-(2-sulfanylethoxy)ethylsulfanyl]acetamide.
| Compound Name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[2-(2-sulfanylethoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 71746064 |
| Molecular Formula | C15H22N2O6S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2-[2-(2-sulfanylethoxy)ethylsulfanyl]acetamide |
| SMILES | O=C(CSCCOCCS)N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H22N2O6S2/c18-9-13(16-14(19)10-25-8-6-23-5-7-24)15(20)11-1-3-12(4-2-11)17(21)22/h1-4,13,15,18,20,24H,5-10H2,(H,16,19)/t13-,15-/m1/s1 |
| InChIKey | KWRNJIKBZOIYEV-UKRRQHHQSA-N |
| XLogP | 0.78 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|