About 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate
2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate (PubChem CID 71746096) has the molecular formula C21H21N3O5
and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate.
Molecular Properties
| Compound Name | 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate |
| PubChem CID | 71746096 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCCn2c(=O)c3ccccc3n(C)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-14-7-9-15(10-8-14)19(26)22-13-18(25)29-12-11-24-20(27)16-5-3-4-6-17(16)23(2)21(24)28/h3-10H,11-13H2,1-2H3,(H,22,26) |
| InChIKey | OARFXTAPBFCISR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate?
The IUPAC name of 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate (CID 71746096) is 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate.
What is the SMILES notation for 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate?
The canonical SMILES for 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate is Cc1ccc(C(=O)NCC(=O)OCCn2c(=O)c3ccccc3n(C)c2=O)cc1.
What is the InChIKey of 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate?
The InChIKey is OARFXTAPBFCISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O5/c1-14-7-9-15(10-8-14)19(26)22-13-18(25)29-12-11-24-20(27)16-5-3-4-6-17(16)23(2)21(24)28/h3-10H,11-13H2,1-2H3,(H,22,26).
What are the key properties of 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate?
2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate has a molecular weight of 395.42 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl 2-[(4-methylbenzoyl)amino]acetate is sourced from PubChem (CID 71746096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).