C22H17FIN5O — CID 71746257
2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 71746257) has the molecular formula C22H17FIN5O and a molecular weight of 513.31 g/mol. Its IUPAC name is 2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 71746257 |
| Molecular Formula | C22H17FIN5O |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-n3nc(Cc4ccccc4F)c4ccccc43)nc(I)c21 |
| InChI | InChI=1S/C22H17FIN5O/c1-22(2)17-18(24)25-21(27-19(17)26-20(22)30)29-16-10-6-4-8-13(16)15(28-29)11-12-7-3-5-9-14(12)23/h3-10H,11H2,1-2H3,(H,25,26,27,30) |
| InChIKey | KQPYXXVLNFSPFT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|