C13H22O4 — CID 71746439
(E)-4-[(1R,4S,5S,6R)-1,4,5-trihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one (PubChem CID 71746439) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (E)-4-[(1R,4S,5S,6R)-1,4,5-trihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one.
| Compound Name | (E)-4-[(1R,4S,5S,6R)-1,4,5-trihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 71746439 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (E)-4-[(1R,4S,5S,6R)-1,4,5-trihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@]1(O)[C@H](C)[C@H](O)[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C13H22O4/c1-8(14)5-6-13(17)9(2)11(16)10(15)7-12(13,3)4/h5-6,9-11,15-17H,7H2,1-4H3/b6-5+/t9-,10+,11+,13-/m1/s1 |
| InChIKey | OJRIULXCUMIXBT-VZTUNGRISA-N |
| XLogP | 0.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|