C16H20ClF3N2O — CID 71746486
(2S,4aR,8aR)-4-[3-chloro-4-(difluoromethoxy)-5-fluorophenyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline (PubChem CID 71746486) has the molecular formula C16H20ClF3N2O and a molecular weight of 348.80 g/mol. Its IUPAC name is (2S,4aR,8aR)-4-[3-chloro-4-(difluoromethoxy)-5-fluorophenyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline.
| Compound Name | (2S,4aR,8aR)-4-[3-chloro-4-(difluoromethoxy)-5-fluorophenyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
|---|---|
| PubChem CID | 71746486 |
| Molecular Formula | C16H20ClF3N2O |
| Molecular Weight | 348.80 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2S,4aR,8aR)-4-[3-chloro-4-(difluoromethoxy)-5-fluorophenyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
| SMILES | C[C@H]1CN(c2cc(F)c(OC(F)F)c(Cl)c2)[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C16H20ClF3N2O/c1-9-8-22(14-5-3-2-4-13(14)21-9)10-6-11(17)15(12(18)7-10)23-16(19)20/h6-7,9,13-14,16,21H,2-5,8H2,1H3/t9-,13+,14+/m0/s1 |
| InChIKey | RAHZBDPJYBIGEH-CUOATXAZSA-N |
| XLogP | 4.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|