C13H24O5 — CID 71746620
(1R,2R,3R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethylcyclohexane-1,2,3,4-tetrol (PubChem CID 71746620) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1R,2R,3R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethylcyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethylcyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 71746620 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (1R,2R,3R,4S)-1-[(E,3R)-3-hydroxybut-1-enyl]-2,6,6-trimethylcyclohexane-1,2,3,4-tetrol |
| SMILES | C[C@@H](O)/C=C/[C@@]1(O)C(C)(C)C[C@H](O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C13H24O5/c1-8(14)5-6-13(18)11(2,3)7-9(15)10(16)12(13,4)17/h5-6,8-10,14-18H,7H2,1-4H3/b6-5+/t8-,9+,10-,12-,13-/m1/s1 |
| InChIKey | OPHSNQSZCRVYBC-SARQSPIOSA-N |
| XLogP | -0.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|