C19H15FN8O — CID 71746817
3-[1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 71746817) has the molecular formula C19H15FN8O and a molecular weight of 390.38 g/mol. Its IUPAC name is 3-[1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 71746817 |
| Molecular Formula | C19H15FN8O |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nn(Cc4ccccc4F)c4ncncc34)nnc21 |
| InChI | InChI=1S/C19H15FN8O/c1-19(2)14-16(24-18(19)29)23-15(26-25-14)13-11-7-21-9-22-17(11)28(27-13)8-10-5-3-4-6-12(10)20/h3-7,9H,8H2,1-2H3,(H,23,24,26,29) |
| InChIKey | NAYKFQCEFZWJEA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |