About ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate
ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate (PubChem CID 71746885) has the molecular formula C24H17F3O6
and a molecular weight of 458.39 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate |
| PubChem CID | 71746885 |
| Molecular Formula | C24H17F3O6 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)OC2=C(C(=O)c3ccccc3C2=O)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H17F3O6/c1-3-32-23(30)18-16(12-8-10-13(31-2)11-9-12)17-19(28)14-6-4-5-7-15(14)20(29)21(17)33-22(18)24(25,26)27/h4-11,16H,3H2,1-2H3 |
| InChIKey | QFSXFACVZIIJAV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate?
The IUPAC name of ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate (CID 71746885) is ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate.
What is the SMILES notation for ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate?
The canonical SMILES for ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate is CCOC(=O)C1=C(C(F)(F)F)OC2=C(C(=O)c3ccccc3C2=O)C1c1ccc(OC)cc1.
What is the InChIKey of ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate?
The InChIKey is QFSXFACVZIIJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F3O6/c1-3-32-23(30)18-16(12-8-10-13(31-2)11-9-12)17-19(28)14-6-4-5-7-15(14)20(29)21(17)33-22(18)24(25,26)27/h4-11,16H,3H2,1-2H3.
What are the key properties of ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate?
ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate has a molecular weight of 458.39 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-methoxyphenyl)-5,10-dioxo-2-(trifluoromethyl)-4H-benzo[g]chromene-3-carboxylate is sourced from PubChem (CID 71746885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).