C22H32O3 — CID 71747207
[(3S,4E,16E,18R)-18-hydroxyicosa-4,16-dien-1,19-diyn-3-yl] acetate (PubChem CID 71747207) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(3S,4E,16E,18R)-18-hydroxyicosa-4,16-dien-1,19-diyn-3-yl] acetate.
| Compound Name | [(3S,4E,16E,18R)-18-hydroxyicosa-4,16-dien-1,19-diyn-3-yl] acetate |
|---|---|
| PubChem CID | 71747207 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(3S,4E,16E,18R)-18-hydroxyicosa-4,16-dien-1,19-diyn-3-yl] acetate |
| SMILES | C#C[C@H](/C=C/CCCCCCCCCC/C=C/[C@@H](O)C#C)OC(C)=O |
| InChI | InChI=1S/C22H32O3/c1-4-21(24)18-16-14-12-10-8-6-7-9-11-13-15-17-19-22(5-2)25-20(3)23/h1-2,16-19,21-22,24H,6-15H2,3H3/b18-16+,19-17+/t21-,22+/m0/s1 |
| InChIKey | HEFOAGVZRBHVPE-WABXBRDYSA-N |
| XLogP | 4.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|