C7H9BrFNO — CID 71747237
(1S,4R,6S,7R)-6-bromo-7-fluoro-2-methyl-2-azabicyclo[2.2.1]heptan-3-one (PubChem CID 71747237) has the molecular formula C7H9BrFNO and a molecular weight of 222.06 g/mol. Its IUPAC name is (1S,4R,6S,7R)-6-bromo-7-fluoro-2-methyl-2-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4R,6S,7R)-6-bromo-7-fluoro-2-methyl-2-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 71747237 |
| Molecular Formula | C7H9BrFNO |
| Molecular Weight | 222.06 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | (1S,4R,6S,7R)-6-bromo-7-fluoro-2-methyl-2-azabicyclo[2.2.1]heptan-3-one |
| SMILES | CN1C(=O)[C@H]2C[C@H](Br)[C@@H]1[C@@H]2F |
| InChI | InChI=1S/C7H9BrFNO/c1-10-6-4(8)2-3(5(6)9)7(10)11/h3-6H,2H2,1H3/t3-,4-,5+,6+/m0/s1 |
| InChIKey | LGKLGUFJHXBBKT-UNTFVMJOSA-N |
| XLogP | 0.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|