C9H20ClNO3 — CID 71747328
(2S,3R,5S,6R)-2,6-diethylpiperidine-3,4,5-triol;hydrochloride (PubChem CID 71747328) has the molecular formula C9H20ClNO3 and a molecular weight of 225.72 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2,6-diethylpiperidine-3,4,5-triol;hydrochloride.
| Compound Name | (2S,3R,5S,6R)-2,6-diethylpiperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 71747328 |
| Molecular Formula | C9H20ClNO3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2S,3R,5S,6R)-2,6-diethylpiperidine-3,4,5-triol;hydrochloride |
| SMILES | CC[C@@H]1N[C@H](CC)[C@H](O)C(O)[C@@H]1O.Cl |
| InChI | InChI=1S/C9H19NO3.ClH/c1-3-5-7(11)9(13)8(12)6(4-2)10-5;/h5-13H,3-4H2,1-2H3;1H/t5-,6+,7+,8-,9?; |
| InChIKey | CZOCTXNVINBCEU-QXZVMYEXSA-N |
| XLogP | -0.35 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |