C23H32O5Si — CID 71747391
ethyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxypentanoate (PubChem CID 71747391) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is ethyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxypentanoate.
| Compound Name | ethyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxypentanoate |
|---|---|
| PubChem CID | 71747391 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroxypentanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O5Si/c1-5-27-22(26)21(25)20(24)16-17-28-29(23(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-21,24-25H,5,16-17H2,1-4H3/t20-,21+/m1/s1 |
| InChIKey | RKGBWIZWJCXKRV-RTWAWAEBSA-N |
| XLogP | 2.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|