C40H55N3O7 — CID 71747400
methyl 4-[[4-[[4-amino-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoate (PubChem CID 71747400) has the molecular formula C40H55N3O7 and a molecular weight of 689.89 g/mol. Its IUPAC name is methyl 4-[[4-[[4-amino-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoate.
| Compound Name | methyl 4-[[4-[[4-amino-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoate |
|---|---|
| PubChem CID | 71747400 |
| Molecular Formula | C40H55N3O7 |
| Molecular Weight | 689.89 g/mol |
| Exact Mass | 689.40 |
| IUPAC Name | methyl 4-[[4-[[4-amino-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoyl]amino]-3-(2-ethylbutoxy)benzoate |
| SMILES | CCC(CC)COc1cc(C(=O)Nc2ccc(C(=O)Nc3ccc(C(=O)OC)cc3OCC(CC)CC)cc2OCC(CC)CC)ccc1N |
| InChI | InChI=1S/C40H55N3O7/c1-8-26(9-2)23-48-35-20-29(14-17-32(35)41)38(44)42-33-18-15-30(21-36(33)49-24-27(10-3)11-4)39(45)43-34-19-16-31(40(46)47-7)22-37(34)50-25-28(12-5)13-6/h14-22,26-28H,8-13,23-25,41H2,1-7H3,(H,42,44)(H,43,45) |
| InChIKey | GAZMLJMXWNEDSU-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.89 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|