C18H28O4 — CID 71747580
[(1S,3aS,8aS)-1-methoxy-3a-methyl-3-oxo-1,2,4,5,8,8a-hexahydroazulen-6-yl]methyl 2,2-dimethylpropanoate (PubChem CID 71747580) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(1S,3aS,8aS)-1-methoxy-3a-methyl-3-oxo-1,2,4,5,8,8a-hexahydroazulen-6-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3aS,8aS)-1-methoxy-3a-methyl-3-oxo-1,2,4,5,8,8a-hexahydroazulen-6-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71747580 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(1S,3aS,8aS)-1-methoxy-3a-methyl-3-oxo-1,2,4,5,8,8a-hexahydroazulen-6-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@H]1CC(=O)[C@@]2(C)CCC(COC(=O)C(C)(C)C)=CC[C@H]12 |
| InChI | InChI=1S/C18H28O4/c1-17(2,3)16(20)22-11-12-6-7-13-14(21-5)10-15(19)18(13,4)9-8-12/h6,13-14H,7-11H2,1-5H3/t13-,14+,18+/m1/s1 |
| InChIKey | NPFYFJWJRRWTAC-GLJUWKHASA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|