C24H41ClN4O5 — CID 71747687
(2R,3S,4R,5S)-1-[4-[4-(1-adamantylmethoxymethyl)triazol-1-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (PubChem CID 71747687) has the molecular formula C24H41ClN4O5 and a molecular weight of 501.07 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-[4-[4-(1-adamantylmethoxymethyl)triazol-1-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride.
| Compound Name | (2R,3S,4R,5S)-1-[4-[4-(1-adamantylmethoxymethyl)triazol-1-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 71747687 |
| Molecular Formula | C24H41ClN4O5 |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | (2R,3S,4R,5S)-1-[4-[4-(1-adamantylmethoxymethyl)triazol-1-yl]butyl]-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| SMILES | Cl.OC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)CN1CCCCn1cc(COCC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C24H40N4O5.ClH/c29-13-20-22(31)23(32)21(30)12-27(20)3-1-2-4-28-11-19(25-26-28)14-33-15-24-8-16-5-17(9-24)7-18(6-16)10-24;/h11,16-18,20-23,29-32H,1-10,12-15H2;1H/t16?,17?,18?,20-,21+,22+,23-,24?;/m1./s1 |
| InChIKey | QVEBZQVTSJNIFZ-XCGFNZCESA-N |
| XLogP | 0.97 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|