C11H11ClOS — CID 71747754
10-chloro-2,3,4,6-tetrahydro-1-benzothiocin-5-one (PubChem CID 71747754) has the molecular formula C11H11ClOS and a molecular weight of 226.73 g/mol. Its IUPAC name is 10-chloro-2,3,4,6-tetrahydro-1-benzothiocin-5-one.
| Compound Name | 10-chloro-2,3,4,6-tetrahydro-1-benzothiocin-5-one |
|---|---|
| PubChem CID | 71747754 |
| Molecular Formula | C11H11ClOS |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 10-chloro-2,3,4,6-tetrahydro-1-benzothiocin-5-one |
| SMILES | O=C1CCCSc2c(Cl)cccc2C1 |
| InChI | InChI=1S/C11H11ClOS/c12-10-5-1-3-8-7-9(13)4-2-6-14-11(8)10/h1,3,5H,2,4,6-7H2 |
| InChIKey | MAJFEOKXMZKDMI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |