C20H15BrCl3N5 — CID 71748017
1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 71748017) has the molecular formula C20H15BrCl3N5 and a molecular weight of 511.64 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71748017 |
| Molecular Formula | C20H15BrCl3N5 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 508.96 |
| IUPAC Name | 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(CNc2ncnc3c2cnn3CC(Cl)c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C20H15BrCl3N5/c21-14-4-2-13(3-5-14)18(24)10-29-20-15(9-28-29)19(26-11-27-20)25-8-12-1-6-16(22)17(23)7-12/h1-7,9,11,18H,8,10H2,(H,25,26,27) |
| InChIKey | RTPCKRIWAHHMNW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|