C23H21ClN2O3 — CID 7174830
(3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(4-methylphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 7174830) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(4-methylphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(4-methylphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 7174830 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(4-methylphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H](C(=O)c2ccc(Cl)cc2)N2CCC[C@H]32)cc1 |
| InChI | InChI=1S/C23H21ClN2O3/c1-13-4-10-16(11-5-13)26-22(28)18-17-3-2-12-25(17)20(19(18)23(26)29)21(27)14-6-8-15(24)9-7-14/h4-11,17-20H,2-3,12H2,1H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | DNFVZNPHOQSYCX-FYQPLNBISA-N |
| XLogP | 3.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|